C25H40N2O6S2 — CID 88710377
methyl 4-[[(3aR,5S,6aR)-3-(3-acetyloxyoctyl)-2-oxo-3a-(5-sulfanylideneoxolan-2-yl)-4,5,6,6a-tetrahydro-1H-cyclopenta[d]imidazol-5-yl]sulfanyl]butanoate (PubChem CID 88710377) has the molecular formula C25H40N2O6S2 and a molecular weight of 528.74 g/mol. Its IUPAC name is methyl 4-[[(3aR,5S,6aR)-3-(3-acetyloxyoctyl)-2-oxo-3a-(5-sulfanylideneoxolan-2-yl)-4,5,6,6a-tetrahydro-1H-cyclopenta[d]imidazol-5-yl]sulfanyl]butanoate.
| Compound Name | methyl 4-[[(3aR,5S,6aR)-3-(3-acetyloxyoctyl)-2-oxo-3a-(5-sulfanylideneoxolan-2-yl)-4,5,6,6a-tetrahydro-1H-cyclopenta[d]imidazol-5-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 88710377 |
| Molecular Formula | C25H40N2O6S2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | methyl 4-[[(3aR,5S,6aR)-3-(3-acetyloxyoctyl)-2-oxo-3a-(5-sulfanylideneoxolan-2-yl)-4,5,6,6a-tetrahydro-1H-cyclopenta[d]imidazol-5-yl]sulfanyl]butanoate |
| SMILES | CCCCCC(CCN1C(=O)N[C@@H]2C[C@H](SCCCC(=O)OC)C[C@]21C1CCC(=S)O1)OC(C)=O |
| InChI | InChI=1S/C25H40N2O6S2/c1-4-5-6-8-18(32-17(2)28)12-13-27-24(30)26-20-15-19(35-14-7-9-22(29)31-3)16-25(20,27)21-10-11-23(34)33-21/h18-21H,4-16H2,1-3H3,(H,26,30)/t18?,19-,20+,21?,25+/m0/s1 |
| InChIKey | DIHPZMDXYSWEKW-VNPLVBQWSA-N |
| XLogP | 4.38 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|