C18H13ClN2O3 — CID 88711769
2-(2-methoxy-4-prop-2-ynoxyphenyl)-3H-benzimidazole-5-carbonyl chloride (PubChem CID 88711769) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is 2-(2-methoxy-4-prop-2-ynoxyphenyl)-3H-benzimidazole-5-carbonyl chloride.
| Compound Name | 2-(2-methoxy-4-prop-2-ynoxyphenyl)-3H-benzimidazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 88711769 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-(2-methoxy-4-prop-2-ynoxyphenyl)-3H-benzimidazole-5-carbonyl chloride |
| SMILES | C#CCOc1ccc(-c2nc3ccc(C(=O)Cl)cc3[nH]2)c(OC)c1 |
| InChI | InChI=1S/C18H13ClN2O3/c1-3-8-24-12-5-6-13(16(10-12)23-2)18-20-14-7-4-11(17(19)22)9-15(14)21-18/h1,4-7,9-10H,8H2,2H3,(H,20,21) |
| InChIKey | YLFOGHHMILYVKT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|