C11H12N2O3S2 — CID 88715739
N-(1-acetyl-2-oxo-4-sulfanylazetidin-3-yl)-2-thiophen-3-ylacetamide (PubChem CID 88715739) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(1-acetyl-2-oxo-4-sulfanylazetidin-3-yl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(1-acetyl-2-oxo-4-sulfanylazetidin-3-yl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 88715739 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | N-(1-acetyl-2-oxo-4-sulfanylazetidin-3-yl)-2-thiophen-3-ylacetamide |
| SMILES | CC(=O)N1C(=O)C(NC(=O)Cc2ccsc2)C1S |
| InChI | InChI=1S/C11H12N2O3S2/c1-6(14)13-10(16)9(11(13)17)12-8(15)4-7-2-3-18-5-7/h2-3,5,9,11,17H,4H2,1H3,(H,12,15) |
| InChIKey | HNLYOPDRPOAWMU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|