About 2-(2-aminophenyl)acetic acid;pent-1-yne
2-(2-aminophenyl)acetic acid;pent-1-yne (PubChem CID 88718243) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(2-aminophenyl)acetic acid;pent-1-yne.
Molecular Properties
| Compound Name | 2-(2-aminophenyl)acetic acid;pent-1-yne |
| PubChem CID | 88718243 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(2-aminophenyl)acetic acid;pent-1-yne |
| SMILES | C#CCCC.Nc1ccccc1CC(=O)O |
| InChI | InChI=1S/C8H9NO2.C5H8/c9-7-4-2-1-3-6(7)5-8(10)11;1-3-5-4-2/h1-4H,5,9H2,(H,10,11);1H,4-5H2,2H3 |
| InChIKey | CVAUDWBMGOHRAB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminophenyl)acetic acid;pent-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminophenyl)acetic acid;pent-1-yne?
The IUPAC name of 2-(2-aminophenyl)acetic acid;pent-1-yne (CID 88718243) is 2-(2-aminophenyl)acetic acid;pent-1-yne.
What is the SMILES notation for 2-(2-aminophenyl)acetic acid;pent-1-yne?
The canonical SMILES for 2-(2-aminophenyl)acetic acid;pent-1-yne is C#CCCC.Nc1ccccc1CC(=O)O.
What is the InChIKey of 2-(2-aminophenyl)acetic acid;pent-1-yne?
The InChIKey is CVAUDWBMGOHRAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C5H8/c9-7-4-2-1-3-6(7)5-8(10)11;1-3-5-4-2/h1-4H,5,9H2,(H,10,11);1H,4-5H2,2H3.
What are the key properties of 2-(2-aminophenyl)acetic acid;pent-1-yne?
2-(2-aminophenyl)acetic acid;pent-1-yne has a molecular weight of 219.28 g/mol, XLogP of 2.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminophenyl)acetic acid;pent-1-yne is sourced from PubChem (CID 88718243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).