C15H16N4O6S2 — CID 88722375
methyl 5-[(4-methoxy-6-methylpyrimidin-2-yl)carbamoylsulfamoyl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylate (PubChem CID 88722375) has the molecular formula C15H16N4O6S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is methyl 5-[(4-methoxy-6-methylpyrimidin-2-yl)carbamoylsulfamoyl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylate.
| Compound Name | methyl 5-[(4-methoxy-6-methylpyrimidin-2-yl)carbamoylsulfamoyl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 88722375 |
| Molecular Formula | C15H16N4O6S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | methyl 5-[(4-methoxy-6-methylpyrimidin-2-yl)carbamoylsulfamoyl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC=CC(S(=O)(=O)NC(=O)Nc2nc(C)cc(OC)n2)C1=S |
| InChI | InChI=1S/C15H16N4O6S2/c1-8-7-11(24-2)17-14(16-8)18-15(21)19-27(22,23)10-6-4-5-9(12(10)26)13(20)25-3/h4-7,10H,1-3H3,(H2,16,17,18,19,21) |
| InChIKey | IBQWHYMQHMIWTM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|