C40H72N4O10S — CID 88723789
(4R)-5-amino-4-[[(2S)-2-[[2-(decanoylamino)-3-sulfanylpropanoyl]-[(2R)-2,3-di(octanoyloxy)propyl]amino]propanoyl]amino]-5-oxopentanoic acid (PubChem CID 88723789) has the molecular formula C40H72N4O10S and a molecular weight of 801.10 g/mol. Its IUPAC name is (4R)-5-amino-4-[[(2S)-2-[[2-(decanoylamino)-3-sulfanylpropanoyl]-[(2R)-2,3-di(octanoyloxy)propyl]amino]propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4R)-5-amino-4-[[(2S)-2-[[2-(decanoylamino)-3-sulfanylpropanoyl]-[(2R)-2,3-di(octanoyloxy)propyl]amino]propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 88723789 |
| Molecular Formula | C40H72N4O10S |
| Molecular Weight | 801.10 g/mol |
| Exact Mass | 800.50 |
| IUPAC Name | (4R)-5-amino-4-[[(2S)-2-[[2-(decanoylamino)-3-sulfanylpropanoyl]-[(2R)-2,3-di(octanoyloxy)propyl]amino]propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CCCCCCCCCC(=O)NC(CS)C(=O)N(C[C@H](COC(=O)CCCCCCC)OC(=O)CCCCCCC)[C@@H](C)C(=O)N[C@H](CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C40H72N4O10S/c1-5-8-11-14-15-18-19-22-34(45)42-33(29-55)40(52)44(30(4)39(51)43-32(38(41)50)25-26-35(46)47)27-31(54-37(49)24-21-17-13-10-7-3)28-53-36(48)23-20-16-12-9-6-2/h30-33,55H,5-29H2,1-4H3,(H2,41,50)(H,42,45)(H,43,51)(H,46,47)/t30-,31+,32+,33?/m0/s1 |
| InChIKey | QTWQZRXFTSBBFF-UKMVECHMSA-N |
| XLogP | 5.77 |
| TPSA | 211.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.10 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|