C9H15ClN6O — CID 88724036
6-chloro-4-N-ethyl-2-N-(1-methoxyiminopropan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 88724036) has the molecular formula C9H15ClN6O and a molecular weight of 258.71 g/mol. Its IUPAC name is 6-chloro-4-N-ethyl-2-N-(1-methoxyiminopropan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-ethyl-2-N-(1-methoxyiminopropan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 88724036 |
| Molecular Formula | C9H15ClN6O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 6-chloro-4-N-ethyl-2-N-(1-methoxyiminopropan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Cl)nc(NC(C)C=NOC)n1 |
| InChI | InChI=1S/C9H15ClN6O/c1-4-11-8-14-7(10)15-9(16-8)13-6(2)5-12-17-3/h5-6H,4H2,1-3H3,(H2,11,13,14,15,16) |
| InChIKey | ZIMPHWJZKUMNTJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|