C28H43NO3S — CID 88730359
4-methylbenzenesulfonate;tributyl(1-phenylprop-2-enyl)azanium (PubChem CID 88730359) has the molecular formula C28H43NO3S and a molecular weight of 473.72 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;tributyl(1-phenylprop-2-enyl)azanium.
| Compound Name | 4-methylbenzenesulfonate;tributyl(1-phenylprop-2-enyl)azanium |
|---|---|
| PubChem CID | 88730359 |
| Molecular Formula | C28H43NO3S |
| Molecular Weight | 473.72 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | 4-methylbenzenesulfonate;tributyl(1-phenylprop-2-enyl)azanium |
| SMILES | C=CC(c1ccccc1)[N+](CCCC)(CCCC)CCCC.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C21H36N.C7H8O3S/c1-5-9-17-22(18-10-6-2,19-11-7-3)21(8-4)20-15-13-12-14-16-20;1-6-2-4-7(5-3-6)11(8,9)10/h8,12-16,21H,4-7,9-11,17-19H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | YKXQCFSIOPILAM-UHFFFAOYSA-M |
| XLogP | 7.03 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.72 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|