C24H22ClNO3 — CID 88731277
4-[[4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]benzoyl]amino]benzoyl chloride (PubChem CID 88731277) has the molecular formula C24H22ClNO3 and a molecular weight of 407.90 g/mol. Its IUPAC name is 4-[[4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]benzoyl]amino]benzoyl chloride.
| Compound Name | 4-[[4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]benzoyl]amino]benzoyl chloride |
|---|---|
| PubChem CID | 88731277 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-[[4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]benzoyl]amino]benzoyl chloride |
| SMILES | Cc1cc(C(C)(C)c2ccc(C(=O)Nc3ccc(C(=O)Cl)cc3)cc2)ccc1O |
| InChI | InChI=1S/C24H22ClNO3/c1-15-14-19(10-13-21(15)27)24(2,3)18-8-4-17(5-9-18)23(29)26-20-11-6-16(7-12-20)22(25)28/h4-14,27H,1-3H3,(H,26,29) |
| InChIKey | WXEOPIPXWYDNME-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|