C11H20NO6PS — CID 88734745
ethyl 3-(2-dimethoxyphosphorylpropanoyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 88734745) has the molecular formula C11H20NO6PS and a molecular weight of 325.32 g/mol. Its IUPAC name is ethyl 3-(2-dimethoxyphosphorylpropanoyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | ethyl 3-(2-dimethoxyphosphorylpropanoyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 88734745 |
| Molecular Formula | C11H20NO6PS |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | ethyl 3-(2-dimethoxyphosphorylpropanoyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCOC(=O)C1CSCN1C(=O)C(C)P(=O)(OC)OC |
| InChI | InChI=1S/C11H20NO6PS/c1-5-18-11(14)9-6-20-7-12(9)10(13)8(2)19(15,16-3)17-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | FXWOROXFUSMAFF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|