C15H20N2O6 — CID 88737203
ethyl 2-[[4-(1,2-dihydroxyethoxy)phenyl]diazenyl]-2-methyl-3-oxobutanoate (PubChem CID 88737203) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is ethyl 2-[[4-(1,2-dihydroxyethoxy)phenyl]diazenyl]-2-methyl-3-oxobutanoate.
| Compound Name | ethyl 2-[[4-(1,2-dihydroxyethoxy)phenyl]diazenyl]-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 88737203 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | ethyl 2-[[4-(1,2-dihydroxyethoxy)phenyl]diazenyl]-2-methyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(/N=N/c1ccc(OC(O)CO)cc1)C(C)=O |
| InChI | InChI=1S/C15H20N2O6/c1-4-22-14(21)15(3,10(2)19)17-16-11-5-7-12(8-6-11)23-13(20)9-18/h5-8,13,18,20H,4,9H2,1-3H3/b17-16+ |
| InChIKey | ROKDZWIWUVVSFS-WUKNDPDISA-N |
| XLogP | 1.37 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|