About methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate
methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate (PubChem CID 88741989) has the molecular formula C17H17ClO6S
and a molecular weight of 384.84 g/mol. Its IUPAC name is methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate.
Molecular Properties
| Compound Name | methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate |
| PubChem CID | 88741989 |
| Molecular Formula | C17H17ClO6S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate |
| SMILES | C.CC(Oc1ccc(Oc2ccc(Cl)cc2)cc1)C(=O)OC=S(=O)=O |
| InChI | InChI=1S/C16H13ClO6S.CH4/c1-11(16(18)21-10-24(19)20)22-13-6-8-15(9-7-13)23-14-4-2-12(17)3-5-14;/h2-11H,1H3;1H4 |
| InChIKey | DVLCAOKBSHGCOG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate?
The IUPAC name of methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate (CID 88741989) is methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate.
What is the SMILES notation for methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate?
The canonical SMILES for methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate is C.CC(Oc1ccc(Oc2ccc(Cl)cc2)cc1)C(=O)OC=S(=O)=O.
What is the InChIKey of methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate?
The InChIKey is DVLCAOKBSHGCOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClO6S.CH4/c1-11(16(18)21-10-24(19)20)22-13-6-8-15(9-7-13)23-14-4-2-12(17)3-5-14;/h2-11H,1H3;1H4.
What are the key properties of methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate?
methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate has a molecular weight of 384.84 g/mol, XLogP of 3.72, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methane;sulfonylmethyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate is sourced from PubChem (CID 88741989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).