C18H19ClN2O4 — CID 158557120
[carbamoyl(methyl)amino] 2-[4-[(4-chlorophenyl)methyl]phenoxy]propanoate (PubChem CID 158557120) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is [carbamoyl(methyl)amino] 2-[4-[(4-chlorophenyl)methyl]phenoxy]propanoate.
| Compound Name | [carbamoyl(methyl)amino] 2-[4-[(4-chlorophenyl)methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 158557120 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [carbamoyl(methyl)amino] 2-[4-[(4-chlorophenyl)methyl]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(Cc2ccc(Cl)cc2)cc1)C(=O)ON(C)C(N)=O |
| InChI | InChI=1S/C18H19ClN2O4/c1-12(17(22)25-21(2)18(20)23)24-16-9-5-14(6-10-16)11-13-3-7-15(19)8-4-13/h3-10,12H,11H2,1-2H3,(H2,20,23) |
| InChIKey | HQKVKQPCOXMYLS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|