About [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate
[2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate (PubChem CID 88742172) has the molecular formula C15H18Cl2O4
and a molecular weight of 333.21 g/mol. Its IUPAC name is [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate |
| PubChem CID | 88742172 |
| Molecular Formula | C15H18Cl2O4 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1(CCCCc2ccc(Cl)c(Cl)c2)CO1 |
| InChI | InChI=1S/C15H18Cl2O4/c1-2-19-14(18)21-15(10-20-15)8-4-3-5-11-6-7-12(16)13(17)9-11/h6-7,9H,2-5,8,10H2,1H3 |
| InChIKey | UHFNHXPZBOBHSR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate?
The IUPAC name of [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate (CID 88742172) is [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate.
What is the SMILES notation for [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate?
The canonical SMILES for [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate is CCOC(=O)OC1(CCCCc2ccc(Cl)c(Cl)c2)CO1.
What is the InChIKey of [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate?
The InChIKey is UHFNHXPZBOBHSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18Cl2O4/c1-2-19-14(18)21-15(10-20-15)8-4-3-5-11-6-7-12(16)13(17)9-11/h6-7,9H,2-5,8,10H2,1H3.
What are the key properties of [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate?
[2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate has a molecular weight of 333.21 g/mol, XLogP of 4.61, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate is sourced from PubChem (CID 88742172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).