C15H18Cl2O4 — CID 88742172
[2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate (PubChem CID 88742172) has the molecular formula C15H18Cl2O4 and a molecular weight of 333.21 g/mol. Its IUPAC name is [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate.
| Compound Name | [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate |
|---|---|
| PubChem CID | 88742172 |
| Molecular Formula | C15H18Cl2O4 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [2-[4-(3,4-dichlorophenyl)butyl]oxiran-2-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1(CCCCc2ccc(Cl)c(Cl)c2)CO1 |
| InChI | InChI=1S/C15H18Cl2O4/c1-2-19-14(18)21-15(10-20-15)8-4-3-5-11-6-7-12(16)13(17)9-11/h6-7,9H,2-5,8,10H2,1H3 |
| InChIKey | UHFNHXPZBOBHSR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|