C13H14N3NaO9S — CID 88744686
sodium (2S,3S)-2-(carbamoyloxymethyl)-3-[hydroxy(phenylmethoxy)carbamoyl]-4-oxoazetidine-1-sulfonate (PubChem CID 88744686) has the molecular formula C13H14N3NaO9S and a molecular weight of 411.32 g/mol. Its IUPAC name is sodium (2S,3S)-2-(carbamoyloxymethyl)-3-[hydroxy(phenylmethoxy)carbamoyl]-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium (2S,3S)-2-(carbamoyloxymethyl)-3-[hydroxy(phenylmethoxy)carbamoyl]-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 88744686 |
| Molecular Formula | C13H14N3NaO9S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | sodium (2S,3S)-2-(carbamoyloxymethyl)-3-[hydroxy(phenylmethoxy)carbamoyl]-4-oxoazetidine-1-sulfonate |
| SMILES | NC(=O)OC[C@@H]1[C@@H](C(=O)N(O)OCc2ccccc2)C(=O)N1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H15N3O9S.Na/c14-13(19)24-7-9-10(11(17)15(9)26(21,22)23)12(18)16(20)25-6-8-4-2-1-3-5-8;/h1-5,9-10,20H,6-7H2,(H2,14,19)(H,21,22,23);/q;+1/p-1/t9-,10-;/m1./s1 |
| InChIKey | ZWHSKOXKJPULGV-DHTOPLTISA-M |
| XLogP | -4.28 |
| TPSA | 179.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|