C34H63N3O7SSi — CID 66552854
(2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonate;tetrabutylazanium (PubChem CID 66552854) has the molecular formula C34H63N3O7SSi and a molecular weight of 686.05 g/mol. Its IUPAC name is (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonate;tetrabutylazanium.
| Compound Name | (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonate;tetrabutylazanium |
|---|---|
| PubChem CID | 66552854 |
| Molecular Formula | C34H63N3O7SSi |
| Molecular Weight | 686.05 g/mol |
| Exact Mass | 685.42 |
| IUPAC Name | (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonate;tetrabutylazanium |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](NC(=O)OCc2ccccc2)C(=O)N1S(=O)(=O)[O-].CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C18H28N2O7SSi.C16H36N/c1-18(2,3)29(4,5)27-12-14-15(16(21)20(14)28(23,24)25)19-17(22)26-11-13-9-7-6-8-10-13;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h6-10,14-15H,11-12H2,1-5H3,(H,19,22)(H,23,24,25);5-16H2,1-4H3/q;+1/p-1/t14-,15+;/m1./s1 |
| InChIKey | RMASGMUKFHALFD-LIOBNPLQSA-M |
| XLogP | 6.98 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.05 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|