C19H38O10P2 — CID 88745537
6-butan-2-yloxycarbonyl-4,4,6-triethyl-5,5-diphosphonooctanoic acid (PubChem CID 88745537) has the molecular formula C19H38O10P2 and a molecular weight of 488.45 g/mol. Its IUPAC name is 6-butan-2-yloxycarbonyl-4,4,6-triethyl-5,5-diphosphonooctanoic acid.
| Compound Name | 6-butan-2-yloxycarbonyl-4,4,6-triethyl-5,5-diphosphonooctanoic acid |
|---|---|
| PubChem CID | 88745537 |
| Molecular Formula | C19H38O10P2 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 6-butan-2-yloxycarbonyl-4,4,6-triethyl-5,5-diphosphonooctanoic acid |
| SMILES | CCC(C)OC(=O)C(CC)(CC)C(C(CC)(CC)CCC(=O)O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C19H38O10P2/c1-7-14(6)29-16(22)18(10-4,11-5)19(30(23,24)25,31(26,27)28)17(8-2,9-3)13-12-15(20)21/h14H,7-13H2,1-6H3,(H,20,21)(H2,23,24,25)(H2,26,27,28) |
| InChIKey | ZHOIBQBYKIWFSO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|