8-hydrazinylideneoctanoic acid

C8H16N2O2 — CID 88746391

IUPAC8-hydrazinylideneoctanoic acid
SMILESNN=CCCCCCCC(=O)O
InChIInChI=1S/C8H16N2O2/c9-10-7-5-3-1-2-4-6-8(11)12/h7H,1-6,9H2,(H,11,12)
InChIKeyDFSDJNAQAFYCES-UHFFFAOYSA-N
MW172.23 g/mol
LogP1.36
Rot. Bonds7

About 8-hydrazinylideneoctanoic acid

8-hydrazinylideneoctanoic acid (PubChem CID 88746391) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 8-hydrazinylideneoctanoic acid.

Molecular Properties

Compound Name8-hydrazinylideneoctanoic acid
PubChem CID88746391
Molecular FormulaC8H16N2O2
Molecular Weight172.23 g/mol
Exact Mass172.12
IUPAC Name8-hydrazinylideneoctanoic acid
SMILESNN=CCCCCCCC(=O)O
InChIInChI=1S/C8H16N2O2/c9-10-7-5-3-1-2-4-6-8(11)12/h7H,1-6,9H2,(H,11,12)
InChIKeyDFSDJNAQAFYCES-UHFFFAOYSA-N
XLogP1.36
TPSA75.68 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.23
LogP ≤ 51.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 8-hydrazinylideneoctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(9E)-9-hydroxyiminononanoic acid
CID 135344053
(9Z,30Z)-nonatriaconta-9,30-dienedioic acid
CID 151731001
(9Z,33Z)-dotetraconta-9,33-dienedioic acid
CID 87211353
nonatriaconta-9,30-dienedioic acid
CID 151730999
tetradec-6-enedioic acid
CID 151545129
34-amino-34-oxotetratriacontanoic acid
CID 139682719
24-amino-24-oxotetracosanoic acid
CID 139682769
(E)-12-amino-12-oxododec-10-enoic acid
CID 87055158
tetradecanedioic acid
CID 13185
decanedioic acid;tris(nonanedioic acid)
CID 159759294
decanedioic acid;hexanedioic acid;octanedioic acid
CID 159110511
heptadecanedioic acid
CID 3083765

Frequently Asked Questions

What is the IUPAC name of 8-hydrazinylideneoctanoic acid?
The IUPAC name of 8-hydrazinylideneoctanoic acid (CID 88746391) is 8-hydrazinylideneoctanoic acid.
What is the SMILES notation for 8-hydrazinylideneoctanoic acid?
The canonical SMILES for 8-hydrazinylideneoctanoic acid is NN=CCCCCCCC(=O)O.
What is the InChIKey of 8-hydrazinylideneoctanoic acid?
The InChIKey is DFSDJNAQAFYCES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c9-10-7-5-3-1-2-4-6-8(11)12/h7H,1-6,9H2,(H,11,12).
What are the key properties of 8-hydrazinylideneoctanoic acid?
8-hydrazinylideneoctanoic acid has a molecular weight of 172.23 g/mol, XLogP of 1.36, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydrazinylideneoctanoic acid is sourced from PubChem (CID 88746391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).