C18H22ClNO6S — CID 88746866
5-[1-chloro-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methoxybenzenesulfonic acid (PubChem CID 88746866) has the molecular formula C18H22ClNO6S and a molecular weight of 415.90 g/mol. Its IUPAC name is 5-[1-chloro-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methoxybenzenesulfonic acid.
| Compound Name | 5-[1-chloro-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 88746866 |
| Molecular Formula | C18H22ClNO6S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 5-[1-chloro-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methoxybenzenesulfonic acid |
| SMILES | COc1ccccc1OCCNCC(Cl)c1ccc(OC)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H22ClNO6S/c1-24-15-5-3-4-6-16(15)26-10-9-20-12-14(19)13-7-8-17(25-2)18(11-13)27(21,22)23/h3-8,11,14,20H,9-10,12H2,1-2H3,(H,21,22,23) |
| InChIKey | PZARWHCAVQPLMC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|