C18H15NO3 — CID 88749596
6-(1,2-dimethylindol-3-yl)-5-(oxomethylidene)cyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 88749596) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 6-(1,2-dimethylindol-3-yl)-5-(oxomethylidene)cyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 6-(1,2-dimethylindol-3-yl)-5-(oxomethylidene)cyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 88749596 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 6-(1,2-dimethylindol-3-yl)-5-(oxomethylidene)cyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | Cc1c(C2C(=C=O)C=CC=C2C(=O)O)c2ccccc2n1C |
| InChI | InChI=1S/C18H15NO3/c1-11-16(13-7-3-4-9-15(13)19(11)2)17-12(10-20)6-5-8-14(17)18(21)22/h3-9,17H,1-2H3,(H,21,22) |
| InChIKey | UGWAFUQRIQIVGJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|