About [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride
[(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride (PubChem CID 88751629) has the molecular formula C8H14ClN3O6
and a molecular weight of 283.67 g/mol. Its IUPAC name is [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride.
Molecular Properties
| Compound Name | [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride |
| PubChem CID | 88751629 |
| Molecular Formula | C8H14ClN3O6 |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride |
| SMILES | CCN(OC(=O)CC(N)=O)OC(=O)CC(N)=O.Cl |
| InChI | InChI=1S/C8H13N3O6.ClH/c1-2-11(16-7(14)3-5(9)12)17-8(15)4-6(10)13;/h2-4H2,1H3,(H2,9,12)(H2,10,13);1H |
| InChIKey | JKTZHXITAPJYFX-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride?
The IUPAC name of [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride (CID 88751629) is [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride.
What is the SMILES notation for [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride?
The canonical SMILES for [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride is CCN(OC(=O)CC(N)=O)OC(=O)CC(N)=O.Cl.
What is the InChIKey of [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride?
The InChIKey is JKTZHXITAPJYFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O6.ClH/c1-2-11(16-7(14)3-5(9)12)17-8(15)4-6(10)13;/h2-4H2,1H3,(H2,9,12)(H2,10,13);1H.
What are the key properties of [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride?
[(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride has a molecular weight of 283.67 g/mol, XLogP of -1.60, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-amino-3-oxopropanoyl)oxy-ethylamino] 3-amino-3-oxopropanoate;hydrochloride is sourced from PubChem (CID 88751629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).