C14H15NO4S — CID 88752570
4-methyl-6-(4-sulfonylbutoxy)-1H-quinolin-2-one (PubChem CID 88752570) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-methyl-6-(4-sulfonylbutoxy)-1H-quinolin-2-one.
| Compound Name | 4-methyl-6-(4-sulfonylbutoxy)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 88752570 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-methyl-6-(4-sulfonylbutoxy)-1H-quinolin-2-one |
| SMILES | Cc1cc(=O)[nH]c2ccc(OCCCC=S(=O)=O)cc12 |
| InChI | InChI=1S/C14H15NO4S/c1-10-8-14(16)15-13-5-4-11(9-12(10)13)19-6-2-3-7-20(17)18/h4-5,7-9H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | CPXCHIJXRRYKAU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|