C15H12Cl3NO3S2 — CID 88752651
N-[(4-chlorophenyl)sulfonyl-(3,4-dichlorophenyl)methyl]-2-sulfanylacetamide (PubChem CID 88752651) has the molecular formula C15H12Cl3NO3S2 and a molecular weight of 424.76 g/mol. Its IUPAC name is N-[(4-chlorophenyl)sulfonyl-(3,4-dichlorophenyl)methyl]-2-sulfanylacetamide.
| Compound Name | N-[(4-chlorophenyl)sulfonyl-(3,4-dichlorophenyl)methyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 88752651 |
| Molecular Formula | C15H12Cl3NO3S2 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 422.93 |
| IUPAC Name | N-[(4-chlorophenyl)sulfonyl-(3,4-dichlorophenyl)methyl]-2-sulfanylacetamide |
| SMILES | O=C(CS)NC(c1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12Cl3NO3S2/c16-10-2-4-11(5-3-10)24(21,22)15(19-14(20)8-23)9-1-6-12(17)13(18)7-9/h1-7,15,23H,8H2,(H,19,20) |
| InChIKey | TXAASOJUKZGUAZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|