C20H20N2O3S2 — CID 88753186
1,3-benzothiazole;6-(4-sulfinylbutoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 88753186) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1,3-benzothiazole;6-(4-sulfinylbutoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 1,3-benzothiazole;6-(4-sulfinylbutoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 88753186 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1,3-benzothiazole;6-(4-sulfinylbutoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=S=CCCCOc1ccc2c(c1)CCC(=O)N2.c1ccc2scnc2c1 |
| InChI | InChI=1S/C13H15NO3S.C7H5NS/c15-13-6-3-10-9-11(4-5-12(10)14-13)17-7-1-2-8-18-16;1-2-4-7-6(3-1)8-5-9-7/h4-5,8-9H,1-3,6-7H2,(H,14,15);1-5H |
| InChIKey | OQYCLEKSLHWGMS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|