C20H24N2O2 — CID 88753877
(1S,9R,10R,11R,12S)-4-methoxy-11,12-dimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbonitrile (PubChem CID 88753877) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1S,9R,10R,11R,12S)-4-methoxy-11,12-dimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbonitrile.
| Compound Name | (1S,9R,10R,11R,12S)-4-methoxy-11,12-dimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbonitrile |
|---|---|
| PubChem CID | 88753877 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (1S,9R,10R,11R,12S)-4-methoxy-11,12-dimethyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbonitrile |
| SMILES | COc1ccc2c(c1)[C@]13CCN(C#N)[C@H](C2)[C@@H]1[C@@H](C)[C@H](C)C(=O)C3 |
| InChI | InChI=1S/C20H24N2O2/c1-12-13(2)19-17-8-14-4-5-15(24-3)9-16(14)20(19,10-18(12)23)6-7-22(17)11-21/h4-5,9,12-13,17,19H,6-8,10H2,1-3H3/t12-,13-,17+,19-,20+/m0/s1 |
| InChIKey | PVFSROIEOVWDTP-URMOITLNSA-N |
| XLogP | 2.91 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|