C13H12N4S — CID 88757082
5-methyl-N-naphthalen-2-ylsulfanyl-1H-1,2,4-triazol-3-amine (PubChem CID 88757082) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 5-methyl-N-naphthalen-2-ylsulfanyl-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-methyl-N-naphthalen-2-ylsulfanyl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 88757082 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 5-methyl-N-naphthalen-2-ylsulfanyl-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1nc(NSc2ccc3ccccc3c2)n[nH]1 |
| InChI | InChI=1S/C13H12N4S/c1-9-14-13(16-15-9)17-18-12-7-6-10-4-2-3-5-11(10)8-12/h2-8H,1H3,(H2,14,15,16,17) |
| InChIKey | XANUTIWZLGHMBS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|