C20H38O10S2 — CID 88760394
3-[[4-(2-ethyl-2-sulfohexoxy)-4-oxobutanoyl]oxymethyl]heptane-3-sulfonic acid (PubChem CID 88760394) has the molecular formula C20H38O10S2 and a molecular weight of 502.65 g/mol. Its IUPAC name is 3-[[4-(2-ethyl-2-sulfohexoxy)-4-oxobutanoyl]oxymethyl]heptane-3-sulfonic acid.
| Compound Name | 3-[[4-(2-ethyl-2-sulfohexoxy)-4-oxobutanoyl]oxymethyl]heptane-3-sulfonic acid |
|---|---|
| PubChem CID | 88760394 |
| Molecular Formula | C20H38O10S2 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 3-[[4-(2-ethyl-2-sulfohexoxy)-4-oxobutanoyl]oxymethyl]heptane-3-sulfonic acid |
| SMILES | CCCCC(CC)(COC(=O)CCC(=O)OCC(CC)(CCCC)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C20H38O10S2/c1-5-9-13-19(7-3,31(23,24)25)15-29-17(21)11-12-18(22)30-16-20(8-4,14-10-6-2)32(26,27)28/h5-16H2,1-4H3,(H,23,24,25)(H,26,27,28) |
| InChIKey | LKRAWFNUINJOQH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|