About CID 88760647
CID 88760647 (PubChem CID 88760647) has the molecular formula C7H13O2SSi
and a molecular weight of 189.33 g/mol.
Molecular Properties
| Compound Name | CID 88760647 |
| PubChem CID | 88760647 |
| Molecular Formula | C7H13O2SSi |
| Molecular Weight | 189.33 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | — |
| SMILES | C=CC(C(S)C(=O)O)[Si](C)C |
| InChI | InChI=1S/C7H13O2SSi/c1-4-5(11(2)3)6(10)7(8)9/h4-6,10H,1H2,2-3H3,(H,8,9) |
| InChIKey | QDRJTDLYSSGDDN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 88760647 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88760647?
The IUPAC name of CID 88760647 (CID 88760647) is not available.
What is the SMILES notation for CID 88760647?
The canonical SMILES for CID 88760647 is C=CC(C(S)C(=O)O)[Si](C)C.
What is the InChIKey of CID 88760647?
The InChIKey is QDRJTDLYSSGDDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13O2SSi/c1-4-5(11(2)3)6(10)7(8)9/h4-6,10H,1H2,2-3H3,(H,8,9).
What are the key properties of CID 88760647?
CID 88760647 has a molecular weight of 189.33 g/mol, XLogP of 1.68, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88760647 is sourced from PubChem (CID 88760647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).