C14H17N3O3 — CID 88762159
methyl (2R)-2-acetamido-3-[4-(cyanoamino)phenyl]-2-methylpropanoate (PubChem CID 88762159) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-[4-(cyanoamino)phenyl]-2-methylpropanoate.
| Compound Name | methyl (2R)-2-acetamido-3-[4-(cyanoamino)phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 88762159 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | methyl (2R)-2-acetamido-3-[4-(cyanoamino)phenyl]-2-methylpropanoate |
| SMILES | COC(=O)[C@@](C)(Cc1ccc(NC#N)cc1)NC(C)=O |
| InChI | InChI=1S/C14H17N3O3/c1-10(18)17-14(2,13(19)20-3)8-11-4-6-12(7-5-11)16-9-15/h4-7,16H,8H2,1-3H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | CVKNTHWKAFSRTN-CQSZACIVSA-N |
| XLogP | 1.19 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|