C15H23NO7 — CID 88769735
2-[(2,3,4,5,6-pentamethoxyphenyl)methylamino]propanoic acid (PubChem CID 88769735) has the molecular formula C15H23NO7 and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentamethoxyphenyl)methylamino]propanoic acid.
| Compound Name | 2-[(2,3,4,5,6-pentamethoxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 88769735 |
| Molecular Formula | C15H23NO7 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 2-[(2,3,4,5,6-pentamethoxyphenyl)methylamino]propanoic acid |
| SMILES | COc1c(CNC(C)C(=O)O)c(OC)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C15H23NO7/c1-8(15(17)18)16-7-9-10(19-2)12(21-4)14(23-6)13(22-5)11(9)20-3/h8,16H,7H2,1-6H3,(H,17,18) |
| InChIKey | KNFGQSKCWCNLBU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |