C56H70Cl4MgN4O8 — CID 88769876
magnesium bis(2-[2-[6-[4-[bis(4-chlorophenyl)methyl]piperidin-1-yl]hexylamino]-2-oxoethoxy]acetate) (PubChem CID 88769876) has the molecular formula C56H70Cl4MgN4O8 and a molecular weight of 1093.31 g/mol. Its IUPAC name is magnesium bis(2-[2-[6-[4-[bis(4-chlorophenyl)methyl]piperidin-1-yl]hexylamino]-2-oxoethoxy]acetate).
| Compound Name | magnesium bis(2-[2-[6-[4-[bis(4-chlorophenyl)methyl]piperidin-1-yl]hexylamino]-2-oxoethoxy]acetate) |
|---|---|
| PubChem CID | 88769876 |
| Molecular Formula | C56H70Cl4MgN4O8 |
| Molecular Weight | 1093.31 g/mol |
| Exact Mass | 1090.38 |
| IUPAC Name | magnesium bis(2-[2-[6-[4-[bis(4-chlorophenyl)methyl]piperidin-1-yl]hexylamino]-2-oxoethoxy]acetate) |
| SMILES | O=C([O-])COCC(=O)NCCCCCCN1CCC(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1.O=C([O-])COCC(=O)NCCCCCCN1CCC(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1.[Mg+2] |
| InChI | InChI=1S/2C28H36Cl2N2O4.Mg/c2*29-24-9-5-21(6-10-24)28(22-7-11-25(30)12-8-22)23-13-17-32(18-14-23)16-4-2-1-3-15-31-26(33)19-36-20-27(34)35;/h2*5-12,23,28H,1-4,13-20H2,(H,31,33)(H,34,35);/q;;+2/p-2 |
| InChIKey | HYCQJUIOWBCZHI-UHFFFAOYSA-L |
| XLogP | 8.18 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1093.31 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|