C24H48OSi — CID 88770784
[2-ethyl-6-[(1S,2S)-2-oct-1-enylcyclopentyl]hexoxy]-trimethylsilane (PubChem CID 88770784) has the molecular formula C24H48OSi and a molecular weight of 380.73 g/mol. Its IUPAC name is [2-ethyl-6-[(1S,2S)-2-oct-1-enylcyclopentyl]hexoxy]-trimethylsilane.
| Compound Name | [2-ethyl-6-[(1S,2S)-2-oct-1-enylcyclopentyl]hexoxy]-trimethylsilane |
|---|---|
| PubChem CID | 88770784 |
| Molecular Formula | C24H48OSi |
| Molecular Weight | 380.73 g/mol |
| Exact Mass | 380.35 |
| IUPAC Name | [2-ethyl-6-[(1S,2S)-2-oct-1-enylcyclopentyl]hexoxy]-trimethylsilane |
| SMILES | CCCCCCC=C[C@H]1CCC[C@@H]1CCCCC(CC)CO[Si](C)(C)C |
| InChI | InChI=1S/C24H48OSi/c1-6-8-9-10-11-12-17-23-19-15-20-24(23)18-14-13-16-22(7-2)21-25-26(3,4)5/h12,17,22-24H,6-11,13-16,18-21H2,1-5H3/t22?,23-,24-/m0/s1 |
| InChIKey | FENNMAWWKLXZDI-VYCPFJESSA-N |
| XLogP | 8.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.73 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|