C6H12N3O7P — CID 88773864
tris(2-amino-2-oxoethyl) phosphate (PubChem CID 88773864) has the molecular formula C6H12N3O7P and a molecular weight of 269.15 g/mol. Its IUPAC name is tris(2-amino-2-oxoethyl) phosphate.
| Compound Name | tris(2-amino-2-oxoethyl) phosphate |
|---|---|
| PubChem CID | 88773864 |
| Molecular Formula | C6H12N3O7P |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | tris(2-amino-2-oxoethyl) phosphate |
| SMILES | NC(=O)COP(=O)(OCC(N)=O)OCC(N)=O |
| InChI | InChI=1S/C6H12N3O7P/c7-4(10)1-14-17(13,15-2-5(8)11)16-3-6(9)12/h1-3H2,(H2,7,10)(H2,8,11)(H2,9,12) |
| InChIKey | RBWZKUZLDBDMOI-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 174.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|