C8H18N2O11P2 — CID 88817359
2-[(2-amino-2-oxoethoxy)-hydroxyphosphoryl]oxyethyl (2-amino-2-oxoethyl) 2-hydroxyethyl phosphate (PubChem CID 88817359) has the molecular formula C8H18N2O11P2 and a molecular weight of 380.18 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethoxy)-hydroxyphosphoryl]oxyethyl (2-amino-2-oxoethyl) 2-hydroxyethyl phosphate.
| Compound Name | 2-[(2-amino-2-oxoethoxy)-hydroxyphosphoryl]oxyethyl (2-amino-2-oxoethyl) 2-hydroxyethyl phosphate |
|---|---|
| PubChem CID | 88817359 |
| Molecular Formula | C8H18N2O11P2 |
| Molecular Weight | 380.18 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2-[(2-amino-2-oxoethoxy)-hydroxyphosphoryl]oxyethyl (2-amino-2-oxoethyl) 2-hydroxyethyl phosphate |
| SMILES | NC(=O)COP(=O)(O)OCCOP(=O)(OCCO)OCC(N)=O |
| InChI | InChI=1S/C8H18N2O11P2/c9-7(12)5-20-22(14,15)17-3-4-19-23(16,18-2-1-11)21-6-8(10)13/h11H,1-6H2,(H2,9,12)(H2,10,13)(H,14,15) |
| InChIKey | HGWSKCJQQCQINI-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 206.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.18 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|