2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid

C4H10N2O7S — CID 87094511

IUPAC2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid
SMILESNC(=O)COCC(N)=O.O=S(=O)(O)O
InChIInChI=1S/C4H8N2O3.H2O4S/c5-3(7)1-9-2-4(6)8;1-5(2,3)4/h1-2H2,(H2,5,7)(H2,6,8);(H2,1,2,3,4)
InChIKeyNAHRSMOYKQPTPJ-UHFFFAOYSA-N
MW230.20 g/mol
LogP-2.68
Rot. Bonds4

About 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid

2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid (PubChem CID 87094511) has the molecular formula C4H10N2O7S and a molecular weight of 230.20 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid.

Molecular Properties

Compound Name2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid
PubChem CID87094511
Molecular FormulaC4H10N2O7S
Molecular Weight230.20 g/mol
Exact Mass230.02
IUPAC Name2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid
SMILESNC(=O)COCC(N)=O.O=S(=O)(O)O
InChIInChI=1S/C4H8N2O3.H2O4S/c5-3(7)1-9-2-4(6)8;1-5(2,3)4/h1-2H2,(H2,5,7)(H2,6,8);(H2,1,2,3,4)
InChIKeyNAHRSMOYKQPTPJ-UHFFFAOYSA-N
XLogP-2.68
TPSA170.01 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.20
LogP ≤ 5-2.68
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid?
The IUPAC name of 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid (CID 87094511) is 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid.
What is the SMILES notation for 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid?
The canonical SMILES for 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid is NC(=O)COCC(N)=O.O=S(=O)(O)O.
What is the InChIKey of 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid?
The InChIKey is NAHRSMOYKQPTPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O3.H2O4S/c5-3(7)1-9-2-4(6)8;1-5(2,3)4/h1-2H2,(H2,5,7)(H2,6,8);(H2,1,2,3,4).
What are the key properties of 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid?
2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid has a molecular weight of 230.20 g/mol, XLogP of -2.68, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid is sourced from PubChem (CID 87094511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).