C4H10N2O7S — CID 87094511
2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid (PubChem CID 87094511) has the molecular formula C4H10N2O7S and a molecular weight of 230.20 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid.
| Compound Name | 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid |
|---|---|
| PubChem CID | 87094511 |
| Molecular Formula | C4H10N2O7S |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 2-(2-amino-2-oxoethoxy)acetamide;sulfuric acid |
| SMILES | NC(=O)COCC(N)=O.O=S(=O)(O)O |
| InChI | InChI=1S/C4H8N2O3.H2O4S/c5-3(7)1-9-2-4(6)8;1-5(2,3)4/h1-2H2,(H2,5,7)(H2,6,8);(H2,1,2,3,4) |
| InChIKey | NAHRSMOYKQPTPJ-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|