About (2-amino-2-oxoethyl) hypoiodite
(2-amino-2-oxoethyl) hypoiodite (PubChem CID 118501112) has the molecular formula C2H4INO2
and a molecular weight of 200.96 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) hypoiodite.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) hypoiodite |
| PubChem CID | 118501112 |
| Molecular Formula | C2H4INO2 |
| Molecular Weight | 200.96 g/mol |
| Exact Mass | 200.93 |
| IUPAC Name | (2-amino-2-oxoethyl) hypoiodite |
| SMILES | NC(=O)COI |
| InChI | InChI=1S/C2H4INO2/c3-6-1-2(4)5/h1H2,(H2,4,5) |
| InChIKey | PAYZKXZQWHYQFF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.96 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-2-oxoethyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) hypoiodite?
The IUPAC name of (2-amino-2-oxoethyl) hypoiodite (CID 118501112) is (2-amino-2-oxoethyl) hypoiodite.
What is the SMILES notation for (2-amino-2-oxoethyl) hypoiodite?
The canonical SMILES for (2-amino-2-oxoethyl) hypoiodite is NC(=O)COI.
What is the InChIKey of (2-amino-2-oxoethyl) hypoiodite?
The InChIKey is PAYZKXZQWHYQFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4INO2/c3-6-1-2(4)5/h1H2,(H2,4,5).
What are the key properties of (2-amino-2-oxoethyl) hypoiodite?
(2-amino-2-oxoethyl) hypoiodite has a molecular weight of 200.96 g/mol, XLogP of -0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) hypoiodite is sourced from PubChem (CID 118501112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).