About (10-amino-10-oxodecyl) hypoiodite
(10-amino-10-oxodecyl) hypoiodite (PubChem CID 142045548) has the molecular formula C10H20INO2
and a molecular weight of 313.18 g/mol. Its IUPAC name is (10-amino-10-oxodecyl) hypoiodite.
Molecular Properties
| Compound Name | (10-amino-10-oxodecyl) hypoiodite |
| PubChem CID | 142045548 |
| Molecular Formula | C10H20INO2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (10-amino-10-oxodecyl) hypoiodite |
| SMILES | NC(=O)CCCCCCCCCOI |
| InChI | InChI=1S/C10H20INO2/c11-14-9-7-5-3-1-2-4-6-8-10(12)13/h1-9H2,(H2,12,13) |
| InChIKey | VSEOYJPPXVGGSI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (10-amino-10-oxodecyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-amino-10-oxodecyl) hypoiodite?
The IUPAC name of (10-amino-10-oxodecyl) hypoiodite (CID 142045548) is (10-amino-10-oxodecyl) hypoiodite.
What is the SMILES notation for (10-amino-10-oxodecyl) hypoiodite?
The canonical SMILES for (10-amino-10-oxodecyl) hypoiodite is NC(=O)CCCCCCCCCOI.
What is the InChIKey of (10-amino-10-oxodecyl) hypoiodite?
The InChIKey is VSEOYJPPXVGGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20INO2/c11-14-9-7-5-3-1-2-4-6-8-10(12)13/h1-9H2,(H2,12,13).
What are the key properties of (10-amino-10-oxodecyl) hypoiodite?
(10-amino-10-oxodecyl) hypoiodite has a molecular weight of 313.18 g/mol, XLogP of 2.96, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (10-amino-10-oxodecyl) hypoiodite is sourced from PubChem (CID 142045548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).