C13H27NO4 — CID 88777327
2-hydroxypropyl-dimethyl-[2-(2-methylprop-2-enoxy)ethyl]azanium acetate (PubChem CID 88777327) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-hydroxypropyl-dimethyl-[2-(2-methylprop-2-enoxy)ethyl]azanium acetate.
| Compound Name | 2-hydroxypropyl-dimethyl-[2-(2-methylprop-2-enoxy)ethyl]azanium acetate |
|---|---|
| PubChem CID | 88777327 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 2-hydroxypropyl-dimethyl-[2-(2-methylprop-2-enoxy)ethyl]azanium acetate |
| SMILES | C=C(C)COCC[N+](C)(C)CC(C)O.CC(=O)[O-] |
| InChI | InChI=1S/C11H24NO2.C2H4O2/c1-10(2)9-14-7-6-12(4,5)8-11(3)13;1-2(3)4/h11,13H,1,6-9H2,2-5H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | LAXVLBHMDKEYPT-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|