C27H28O4 — CID 88777834
2-methyl-3,5-bis(4-propan-2-ylphenyl)terephthalic acid (PubChem CID 88777834) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-methyl-3,5-bis(4-propan-2-ylphenyl)terephthalic acid.
| Compound Name | 2-methyl-3,5-bis(4-propan-2-ylphenyl)terephthalic acid |
|---|---|
| PubChem CID | 88777834 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-methyl-3,5-bis(4-propan-2-ylphenyl)terephthalic acid |
| SMILES | Cc1c(C(=O)O)cc(-c2ccc(C(C)C)cc2)c(C(=O)O)c1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C27H28O4/c1-15(2)18-6-10-20(11-7-18)23-14-22(26(28)29)17(5)24(25(23)27(30)31)21-12-8-19(9-13-21)16(3)4/h6-16H,1-5H3,(H,28,29)(H,30,31) |
| InChIKey | MKGGYMSHUOBXIS-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |