C10H18N2O6 — CID 88779491
2,7-dimethyl-1,8-dinitrooct-6-ene-2,5-diol (PubChem CID 88779491) has the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2,7-dimethyl-1,8-dinitrooct-6-ene-2,5-diol.
| Compound Name | 2,7-dimethyl-1,8-dinitrooct-6-ene-2,5-diol |
|---|---|
| PubChem CID | 88779491 |
| Molecular Formula | C10H18N2O6 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2,7-dimethyl-1,8-dinitrooct-6-ene-2,5-diol |
| SMILES | CC(=CC(O)CCC(C)(O)C[N+](=O)[O-])C[N+](=O)[O-] |
| InChI | InChI=1S/C10H18N2O6/c1-8(6-11(15)16)5-9(13)3-4-10(2,14)7-12(17)18/h5,9,13-14H,3-4,6-7H2,1-2H3 |
| InChIKey | JNXSNCUVQKEVQK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|