C16H27Br2N3O — CID 88781289
3,5-bis[2-[bromo(ethyl)amino]ethyl]-4-ethoxyaniline (PubChem CID 88781289) has the molecular formula C16H27Br2N3O and a molecular weight of 437.22 g/mol. Its IUPAC name is 3,5-bis[2-[bromo(ethyl)amino]ethyl]-4-ethoxyaniline.
| Compound Name | 3,5-bis[2-[bromo(ethyl)amino]ethyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 88781289 |
| Molecular Formula | C16H27Br2N3O |
| Molecular Weight | 437.22 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 3,5-bis[2-[bromo(ethyl)amino]ethyl]-4-ethoxyaniline |
| SMILES | CCOc1c(CCN(Br)CC)cc(N)cc1CCN(Br)CC |
| InChI | InChI=1S/C16H27Br2N3O/c1-4-20(17)9-7-13-11-15(19)12-14(16(13)22-6-3)8-10-21(18)5-2/h11-12H,4-10,19H2,1-3H3 |
| InChIKey | XONOMEAQUOLVJC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|