C23H34N3O3S+ — CID 8878164
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-pentan-3-ylpyridin-1-ium-1-yl)acetamide (PubChem CID 8878164) has the molecular formula C23H34N3O3S+ and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-pentan-3-ylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-pentan-3-ylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8878164 |
| Molecular Formula | C23H34N3O3S+ |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-pentan-3-ylpyridin-1-ium-1-yl)acetamide |
| SMILES | CCC(CC)c1cc[n+](CC(=O)Nc2ccc(C)c(S(=O)(=O)N(CC)CC)c2)cc1 |
| InChI | InChI=1S/C23H33N3O3S/c1-6-19(7-2)20-12-14-25(15-13-20)17-23(27)24-21-11-10-18(5)22(16-21)30(28,29)26(8-3)9-4/h10-16,19H,6-9,17H2,1-5H3/p+1 |
| InChIKey | WDUPAAKAHYPKTH-UHFFFAOYSA-O |
| XLogP | 3.86 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|