C14H20O4 — CID 88783149
(Z)-7-[(1R,2R,3S,4S)-3-formyl-7-oxabicyclo[2.2.1]heptan-2-yl]hept-6-enoic acid (PubChem CID 88783149) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-formyl-7-oxabicyclo[2.2.1]heptan-2-yl]hept-6-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-formyl-7-oxabicyclo[2.2.1]heptan-2-yl]hept-6-enoic acid |
|---|---|
| PubChem CID | 88783149 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-formyl-7-oxabicyclo[2.2.1]heptan-2-yl]hept-6-enoic acid |
| SMILES | O=C[C@H]1[C@@H](/C=C\CCCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C14H20O4/c15-9-11-10(12-7-8-13(11)18-12)5-3-1-2-4-6-14(16)17/h3,5,9-13H,1-2,4,6-8H2,(H,16,17)/b5-3-/t10-,11+,12-,13+/m1/s1 |
| InChIKey | NGKSKWKCEUOWDF-QHYDCCEHSA-N |
| XLogP | 2.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|