C23H30O3S — CID 70352104
(Z)-7-[(1S,2S,3R,4R)-3-(3-phenylprop-2-enylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-6-enoic acid (PubChem CID 70352104) has the molecular formula C23H30O3S and a molecular weight of 386.56 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3R,4R)-3-(3-phenylprop-2-enylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-6-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,3R,4R)-3-(3-phenylprop-2-enylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-6-enoic acid |
|---|---|
| PubChem CID | 70352104 |
| Molecular Formula | C23H30O3S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (Z)-7-[(1S,2S,3R,4R)-3-(3-phenylprop-2-enylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-6-enoic acid |
| SMILES | O=C(O)CCCC/C=C\[C@H]1[C@@H](CSCC=Cc2ccccc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C23H30O3S/c24-23(25)13-7-2-1-6-12-19-20(22-15-14-21(19)26-22)17-27-16-8-11-18-9-4-3-5-10-18/h3-6,8-12,19-22H,1-2,7,13-17H2,(H,24,25)/b11-8?,12-6-/t19-,20+,21-,22+/m0/s1 |
| InChIKey | AKZFGXIOYBCEQA-VSFUDERTSA-N |
| XLogP | 5.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|