About 2-methylbut-3-enal;2-methylprop-2-en-1-ol
2-methylbut-3-enal;2-methylprop-2-en-1-ol (PubChem CID 88783998) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 2-methylbut-3-enal;2-methylprop-2-en-1-ol.
Molecular Properties
| Compound Name | 2-methylbut-3-enal;2-methylprop-2-en-1-ol |
| PubChem CID | 88783998 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2-methylbut-3-enal;2-methylprop-2-en-1-ol |
| SMILES | C=C(C)CO.C=CC(C)C=O |
| InChI | InChI=1S/C5H8O.C4H8O/c1-3-5(2)4-6;1-4(2)3-5/h3-5H,1H2,2H3;5H,1,3H2,2H3 |
| InChIKey | KCRIAXKJBKENKA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-3-enal;2-methylprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-3-enal;2-methylprop-2-en-1-ol?
The IUPAC name of 2-methylbut-3-enal;2-methylprop-2-en-1-ol (CID 88783998) is 2-methylbut-3-enal;2-methylprop-2-en-1-ol.
What is the SMILES notation for 2-methylbut-3-enal;2-methylprop-2-en-1-ol?
The canonical SMILES for 2-methylbut-3-enal;2-methylprop-2-en-1-ol is C=C(C)CO.C=CC(C)C=O.
What is the InChIKey of 2-methylbut-3-enal;2-methylprop-2-en-1-ol?
The InChIKey is KCRIAXKJBKENKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O.C4H8O/c1-3-5(2)4-6;1-4(2)3-5/h3-5H,1H2,2H3;5H,1,3H2,2H3.
What are the key properties of 2-methylbut-3-enal;2-methylprop-2-en-1-ol?
2-methylbut-3-enal;2-methylprop-2-en-1-ol has a molecular weight of 156.22 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-3-enal;2-methylprop-2-en-1-ol is sourced from PubChem (CID 88783998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).