C16H32O3S — CID 88784146
O-(2,3-dihydroxypropyl) 2-methyldodecanethioate (PubChem CID 88784146) has the molecular formula C16H32O3S and a molecular weight of 304.50 g/mol. Its IUPAC name is O-(2,3-dihydroxypropyl) 2-methyldodecanethioate.
| Compound Name | O-(2,3-dihydroxypropyl) 2-methyldodecanethioate |
|---|---|
| PubChem CID | 88784146 |
| Molecular Formula | C16H32O3S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | O-(2,3-dihydroxypropyl) 2-methyldodecanethioate |
| SMILES | CCCCCCCCCCC(C)C(=S)OCC(O)CO |
| InChI | InChI=1S/C16H32O3S/c1-3-4-5-6-7-8-9-10-11-14(2)16(20)19-13-15(18)12-17/h14-15,17-18H,3-13H2,1-2H3 |
| InChIKey | ZQNHBZKFWHQVLO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|