C10H19FO4P+ — CID 88786117
(3-fluoro-3,7-dimethyl-2-oxooctoxy)-hydroxy-oxophosphanium (PubChem CID 88786117) has the molecular formula C10H19FO4P+ and a molecular weight of 253.23 g/mol. Its IUPAC name is (3-fluoro-3,7-dimethyl-2-oxooctoxy)-hydroxy-oxophosphanium.
| Compound Name | (3-fluoro-3,7-dimethyl-2-oxooctoxy)-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 88786117 |
| Molecular Formula | C10H19FO4P+ |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (3-fluoro-3,7-dimethyl-2-oxooctoxy)-hydroxy-oxophosphanium |
| SMILES | CC(C)CCCC(C)(F)C(=O)CO[P+](=O)O |
| InChI | InChI=1S/C10H18FO4P/c1-8(2)5-4-6-10(3,11)9(12)7-15-16(13)14/h8H,4-7H2,1-3H3/p+1 |
| InChIKey | JWULEPAPYCUUBR-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|