About (4-ethoxyanilino) 3-oxobutanoate
(4-ethoxyanilino) 3-oxobutanoate (PubChem CID 88788821) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is (4-ethoxyanilino) 3-oxobutanoate.
Molecular Properties
| Compound Name | (4-ethoxyanilino) 3-oxobutanoate |
| PubChem CID | 88788821 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (4-ethoxyanilino) 3-oxobutanoate |
| SMILES | CCOc1ccc(NOC(=O)CC(C)=O)cc1 |
| InChI | InChI=1S/C12H15NO4/c1-3-16-11-6-4-10(5-7-11)13-17-12(15)8-9(2)14/h4-7,13H,3,8H2,1-2H3 |
| InChIKey | GXWKWZBREUBTDZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxyanilino) 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxyanilino) 3-oxobutanoate?
The IUPAC name of (4-ethoxyanilino) 3-oxobutanoate (CID 88788821) is (4-ethoxyanilino) 3-oxobutanoate.
What is the SMILES notation for (4-ethoxyanilino) 3-oxobutanoate?
The canonical SMILES for (4-ethoxyanilino) 3-oxobutanoate is CCOc1ccc(NOC(=O)CC(C)=O)cc1.
What is the InChIKey of (4-ethoxyanilino) 3-oxobutanoate?
The InChIKey is GXWKWZBREUBTDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-3-16-11-6-4-10(5-7-11)13-17-12(15)8-9(2)14/h4-7,13H,3,8H2,1-2H3.
What are the key properties of (4-ethoxyanilino) 3-oxobutanoate?
(4-ethoxyanilino) 3-oxobutanoate has a molecular weight of 237.25 g/mol, XLogP of 1.93, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxyanilino) 3-oxobutanoate is sourced from PubChem (CID 88788821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).