C18H38N8O4 — CID 88789459
1-[N'-[6-[[amino-(2-ethoxyethylcarbamoylamino)methylidene]amino]hexyl]carbamimidoyl]-3-(2-ethoxyethyl)urea (PubChem CID 88789459) has the molecular formula C18H38N8O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-[N'-[6-[[amino-(2-ethoxyethylcarbamoylamino)methylidene]amino]hexyl]carbamimidoyl]-3-(2-ethoxyethyl)urea.
| Compound Name | 1-[N'-[6-[[amino-(2-ethoxyethylcarbamoylamino)methylidene]amino]hexyl]carbamimidoyl]-3-(2-ethoxyethyl)urea |
|---|---|
| PubChem CID | 88789459 |
| Molecular Formula | C18H38N8O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | 1-[N'-[6-[[amino-(2-ethoxyethylcarbamoylamino)methylidene]amino]hexyl]carbamimidoyl]-3-(2-ethoxyethyl)urea |
| SMILES | CCOCCNC(=O)N/C(N)=N/CCCCCC/N=C(\N)NC(=O)NCCOCC |
| InChI | InChI=1S/C18H38N8O4/c1-3-29-13-11-23-17(27)25-15(19)21-9-7-5-6-8-10-22-16(20)26-18(28)24-12-14-30-4-2/h3-14H2,1-2H3,(H4,19,21,23,25,27)(H4,20,22,24,26,28) |
| InChIKey | ZLFBALFABCAQRU-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 177.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|