C15H12Br4O6S2 — CID 88790950
2,6-dibromo-4-[2-(3,5-dibromo-4-sulfophenyl)propan-2-yl]benzenesulfonic acid (PubChem CID 88790950) has the molecular formula C15H12Br4O6S2 and a molecular weight of 672.00 g/mol. Its IUPAC name is 2,6-dibromo-4-[2-(3,5-dibromo-4-sulfophenyl)propan-2-yl]benzenesulfonic acid.
| Compound Name | 2,6-dibromo-4-[2-(3,5-dibromo-4-sulfophenyl)propan-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 88790950 |
| Molecular Formula | C15H12Br4O6S2 |
| Molecular Weight | 672.00 g/mol |
| Exact Mass | 667.68 |
| IUPAC Name | 2,6-dibromo-4-[2-(3,5-dibromo-4-sulfophenyl)propan-2-yl]benzenesulfonic acid |
| SMILES | CC(C)(c1cc(Br)c(S(=O)(=O)O)c(Br)c1)c1cc(Br)c(S(=O)(=O)O)c(Br)c1 |
| InChI | InChI=1S/C15H12Br4O6S2/c1-15(2,7-3-9(16)13(10(17)4-7)26(20,21)22)8-5-11(18)14(12(19)6-8)27(23,24)25/h3-6H,1-2H3,(H,20,21,22)(H,23,24,25) |
| InChIKey | VAAVHHKJICWVHN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.00 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|